C29H28O4 — CID 100994300
dimethyl 5,6,8-trimethyl-10-[(1E,3E)-4-phenylbuta-1,3-dienyl]heptalene-1,2-dicarboxylate (PubChem CID 100994300) has the molecular formula C29H28O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is dimethyl 5,6,8-trimethyl-10-[(1E,3E)-4-phenylbuta-1,3-dienyl]heptalene-1,2-dicarboxylate.
| Compound Name | dimethyl 5,6,8-trimethyl-10-[(1E,3E)-4-phenylbuta-1,3-dienyl]heptalene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 100994300 |
| Molecular Formula | C29H28O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | dimethyl 5,6,8-trimethyl-10-[(1E,3E)-4-phenylbuta-1,3-dienyl]heptalene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=CC=C(C)C2=C(C)C=C(C)C=C(/C=C/C=C/c3ccccc3)C2=C1C(=O)OC |
| InChI | InChI=1S/C29H28O4/c1-19-17-21(3)25-20(2)15-16-24(28(30)32-4)27(29(31)33-5)26(25)23(18-19)14-10-9-13-22-11-7-6-8-12-22/h6-18H,1-5H3/b13-9+,14-10+ |
| InChIKey | ATQCHVKOGXQCRH-UTLPMFLDSA-N |
| XLogP | 5.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|