C22H18F3NO3 — CID 102010035
17-methyl-1-[(1R)-2,2,2-trifluoro-1-methoxyethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 102010035) has the molecular formula C22H18F3NO3 and a molecular weight of 401.38 g/mol. Its IUPAC name is 17-methyl-1-[(1R)-2,2,2-trifluoro-1-methoxyethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 17-methyl-1-[(1R)-2,2,2-trifluoro-1-methoxyethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 102010035 |
| Molecular Formula | C22H18F3NO3 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 17-methyl-1-[(1R)-2,2,2-trifluoro-1-methoxyethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CO[C@@H](C(F)(F)F)C12c3ccccc3C(c3ccccc31)C1C(=O)N(C)C(=O)C12 |
| InChI | InChI=1S/C22H18F3NO3/c1-26-18(27)16-15-11-7-3-5-9-13(11)21(17(16)19(26)28,20(29-2)22(23,24)25)14-10-6-4-8-12(14)15/h3-10,15-17,20H,1-2H3/t15?,16?,17?,20-,21?/m1/s1 |
| InChIKey | HSHSNWYFXQHFHO-LTUUKXNJSA-N |
| XLogP | 3.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|