C27H22F13NO3 — CID 102010232
ethyl 4-[6-[ethyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]-1-benzofuran-2-yl]benzoate (PubChem CID 102010232) has the molecular formula C27H22F13NO3 and a molecular weight of 655.45 g/mol. Its IUPAC name is ethyl 4-[6-[ethyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]-1-benzofuran-2-yl]benzoate.
| Compound Name | ethyl 4-[6-[ethyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]-1-benzofuran-2-yl]benzoate |
|---|---|
| PubChem CID | 102010232 |
| Molecular Formula | C27H22F13NO3 |
| Molecular Weight | 655.45 g/mol |
| Exact Mass | 655.14 |
| IUPAC Name | ethyl 4-[6-[ethyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]-1-benzofuran-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2cc3ccc(N(CC)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3o2)cc1 |
| InChI | InChI=1S/C27H22F13NO3/c1-3-41(12-11-22(28,29)23(30,31)24(32,33)25(34,35)26(36,37)27(38,39)40)18-10-9-17-13-19(44-20(17)14-18)15-5-7-16(8-6-15)21(42)43-4-2/h5-10,13-14H,3-4,11-12H2,1-2H3 |
| InChIKey | CWZIXRMVNMKYFJ-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.45 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|