C28H29N3O5 — CID 102011117
dimethyl (1R,2R,7S)-2-[bis(prop-2-enyl)amino]-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate (PubChem CID 102011117) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is dimethyl (1R,2R,7S)-2-[bis(prop-2-enyl)amino]-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate.
| Compound Name | dimethyl (1R,2R,7S)-2-[bis(prop-2-enyl)amino]-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 102011117 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | dimethyl (1R,2R,7S)-2-[bis(prop-2-enyl)amino]-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate |
| SMILES | C=CCN(CC=C)[C@H]1C(=O)N2C(C(=O)OC)=C(C(=O)OC)[C@H](c3ccccc3)N2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H29N3O5/c1-5-17-29(18-6-2)25-23(20-15-11-8-12-16-20)30-22(19-13-9-7-10-14-19)21(27(33)35-3)24(28(34)36-4)31(30)26(25)32/h5-16,22-23,25H,1-2,17-18H2,3-4H3/t22-,23+,25+/m0/s1 |
| InChIKey | ACHMUWHMPPZKCE-JBRSBNLGSA-N |
| XLogP | 3.18 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|