C24H24N2O6 — CID 15880041
diethyl (4R,6S)-1-oxo-4,6-diphenyl-4,6-dihydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7,8-dicarboxylate (PubChem CID 15880041) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is diethyl (4R,6S)-1-oxo-4,6-diphenyl-4,6-dihydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7,8-dicarboxylate.
| Compound Name | diethyl (4R,6S)-1-oxo-4,6-diphenyl-4,6-dihydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 15880041 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | diethyl (4R,6S)-1-oxo-4,6-diphenyl-4,6-dihydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N2C(=O)OC[C@@H](c3ccccc3)N2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H24N2O6/c1-3-30-22(27)19-20(17-13-9-6-10-14-17)25-18(16-11-7-5-8-12-16)15-32-24(29)26(25)21(19)23(28)31-4-2/h5-14,18,20H,3-4,15H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | ONMIOXJHSRWKDR-ICSRJNTNSA-N |
| XLogP | 3.53 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|