C23H26N2O4 — CID 101195138
methyl (4R,6S,7R,8R)-8-methyl-1-oxo-4-phenyl-6-(2-phenylethyl)-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7-carboxylate (PubChem CID 101195138) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl (4R,6S,7R,8R)-8-methyl-1-oxo-4-phenyl-6-(2-phenylethyl)-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7-carboxylate.
| Compound Name | methyl (4R,6S,7R,8R)-8-methyl-1-oxo-4-phenyl-6-(2-phenylethyl)-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7-carboxylate |
|---|---|
| PubChem CID | 101195138 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl (4R,6S,7R,8R)-8-methyl-1-oxo-4-phenyl-6-(2-phenylethyl)-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C)N2C(=O)OC[C@@H](c3ccccc3)N2[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C23H26N2O4/c1-16-21(22(26)28-2)19(14-13-17-9-5-3-6-10-17)25-20(15-29-23(27)24(16)25)18-11-7-4-8-12-18/h3-12,16,19-21H,13-15H2,1-2H3/t16-,19+,20+,21-/m1/s1 |
| InChIKey | XXSZBBJAFKWLMK-MBPVOVBZSA-N |
| XLogP | 3.59 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |