C24H26N2O6 — CID 12008491
dimethyl (4R,6S,7S,8R)-1-oxo-4-phenyl-6-(2-phenylethyl)-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7,8-dicarboxylate (PubChem CID 12008491) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is dimethyl (4R,6S,7S,8R)-1-oxo-4-phenyl-6-(2-phenylethyl)-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7,8-dicarboxylate.
| Compound Name | dimethyl (4R,6S,7S,8R)-1-oxo-4-phenyl-6-(2-phenylethyl)-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 12008491 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | dimethyl (4R,6S,7S,8R)-1-oxo-4-phenyl-6-(2-phenylethyl)-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)N2C(=O)OC[C@@H](c3ccccc3)N2[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C24H26N2O6/c1-30-22(27)20-18(14-13-16-9-5-3-6-10-16)25-19(17-11-7-4-8-12-17)15-32-24(29)26(25)21(20)23(28)31-2/h3-12,18-21H,13-15H2,1-2H3/t18-,19-,20-,21+/m0/s1 |
| InChIKey | IQPGGHSJBIFEOT-XSDIEEQYSA-N |
| XLogP | 2.74 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|