C26H24N2O4 — CID 15880043
methyl (4R,6R,7S,8S)-1-oxo-4,6,8-triphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7-carboxylate (PubChem CID 15880043) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is methyl (4R,6R,7S,8S)-1-oxo-4,6,8-triphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7-carboxylate.
| Compound Name | methyl (4R,6R,7S,8S)-1-oxo-4,6,8-triphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7-carboxylate |
|---|---|
| PubChem CID | 15880043 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | methyl (4R,6R,7S,8S)-1-oxo-4,6,8-triphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazine-7-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)N2C(=O)OC[C@@H](c3ccccc3)N2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H24N2O4/c1-31-25(29)22-23(19-13-7-3-8-14-19)27-21(18-11-5-2-6-12-18)17-32-26(30)28(27)24(22)20-15-9-4-10-16-20/h2-16,21-24H,17H2,1H3/t21-,22-,23-,24+/m0/s1 |
| InChIKey | JQHNAMFOIOTKAX-NEWJYFPISA-N |
| XLogP | 4.68 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |