C24H22N2O2 — CID 15880040
(4R,6R,8S)-4,6,8-triphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazin-1-one (PubChem CID 15880040) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (4R,6R,8S)-4,6,8-triphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazin-1-one.
| Compound Name | (4R,6R,8S)-4,6,8-triphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazin-1-one |
|---|---|
| PubChem CID | 15880040 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (4R,6R,8S)-4,6,8-triphenyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-c][1,3,4]oxadiazin-1-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N2[C@@H](c3ccccc3)C[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C24H22N2O2/c27-24-26-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)25(26)23(17-28-24)20-14-8-3-9-15-20/h1-15,21-23H,16-17H2/t21-,22+,23+/m1/s1 |
| InChIKey | XAKDTIPBFYOKRH-VJBWXMMDSA-N |
| XLogP | 5.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |