C28H29NO8 — CID 101478833
2-O-ethyl 3-O,4-O-dimethyl (2R,5S)-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate (PubChem CID 101478833) has the molecular formula C28H29NO8 and a molecular weight of 507.54 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl (2R,5S)-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,5S)-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 101478833 |
| Molecular Formula | C28H29NO8 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,5S)-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-5-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1C(C(=O)OC)=C(C(=O)OC)[C@H](c2ccccc2)N1/C(C)=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H29NO8/c1-5-36-28(33)25-23(27(32)35-4)22(26(31)34-3)24(20-14-10-7-11-15-20)29(25)18(2)16-21(30)37-17-19-12-8-6-9-13-19/h6-16,24-25H,5,17H2,1-4H3/b18-16+/t24-,25+/m0/s1 |
| InChIKey | ZEZQBEQEWZGVFK-CMUYLPBGSA-N |
| XLogP | 3.26 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|