C23H23NO6 — CID 11292752
trimethyl (2R,5S)-5-(4-methylphenyl)-1-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate (PubChem CID 11292752) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is trimethyl (2R,5S)-5-(4-methylphenyl)-1-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2R,5S)-5-(4-methylphenyl)-1-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 11292752 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | trimethyl (2R,5S)-5-(4-methylphenyl)-1-phenyl-2,5-dihydropyrrole-2,3,4-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H](c2ccc(C)cc2)N(c2ccccc2)[C@H]1C(=O)OC |
| InChI | InChI=1S/C23H23NO6/c1-14-10-12-15(13-11-14)19-17(21(25)28-2)18(22(26)29-3)20(23(27)30-4)24(19)16-8-6-5-7-9-16/h5-13,19-20H,1-4H3/t19-,20+/m0/s1 |
| InChIKey | GDTJPJATGNCGAS-VQTJNVASSA-N |
| XLogP | 2.74 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|