C21H26N2O5 — CID 101095700
dimethyl 3,3-dimethyl-1-oxo-5-(2,4,6-trimethylphenyl)-2,5-dihydropyrazolo[1,2-a]pyrazole-6,7-dicarboxylate (PubChem CID 101095700) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is dimethyl 3,3-dimethyl-1-oxo-5-(2,4,6-trimethylphenyl)-2,5-dihydropyrazolo[1,2-a]pyrazole-6,7-dicarboxylate.
| Compound Name | dimethyl 3,3-dimethyl-1-oxo-5-(2,4,6-trimethylphenyl)-2,5-dihydropyrazolo[1,2-a]pyrazole-6,7-dicarboxylate |
|---|---|
| PubChem CID | 101095700 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | dimethyl 3,3-dimethyl-1-oxo-5-(2,4,6-trimethylphenyl)-2,5-dihydropyrazolo[1,2-a]pyrazole-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2C(=O)CC(C)(C)N2C1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H26N2O5/c1-11-8-12(2)15(13(3)9-11)17-16(19(25)27-6)18(20(26)28-7)22-14(24)10-21(4,5)23(17)22/h8-9,17H,10H2,1-7H3 |
| InChIKey | IKIAMNPXKLTLAH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |