C27H26N2O8 — CID 134925665
tetramethyl 1-methyl-7,7-diphenyl-1H-pyrazolo[1,2-a]pyrazole-2,3,5,6-tetracarboxylate (PubChem CID 134925665) has the molecular formula C27H26N2O8 and a molecular weight of 506.51 g/mol. Its IUPAC name is tetramethyl 1-methyl-7,7-diphenyl-1H-pyrazolo[1,2-a]pyrazole-2,3,5,6-tetracarboxylate.
| Compound Name | tetramethyl 1-methyl-7,7-diphenyl-1H-pyrazolo[1,2-a]pyrazole-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 134925665 |
| Molecular Formula | C27H26N2O8 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | tetramethyl 1-methyl-7,7-diphenyl-1H-pyrazolo[1,2-a]pyrazole-2,3,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2C(C(=O)OC)=C(C(=O)OC)C(c3ccccc3)(c3ccccc3)N2C1C |
| InChI | InChI=1S/C27H26N2O8/c1-16-19(23(30)34-2)21(25(32)36-4)28-22(26(33)37-5)20(24(31)35-3)27(29(16)28,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,1-5H3 |
| InChIKey | HGYLMSUWLFSTDR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|