C24H22N2O7 — CID 134983926
trimethyl (1S,2R,7S)-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-2,5,6-tricarboxylate (PubChem CID 134983926) has the molecular formula C24H22N2O7 and a molecular weight of 450.45 g/mol. Its IUPAC name is trimethyl (1S,2R,7S)-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-2,5,6-tricarboxylate.
| Compound Name | trimethyl (1S,2R,7S)-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-2,5,6-tricarboxylate |
|---|---|
| PubChem CID | 134983926 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | trimethyl (1S,2R,7S)-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-2,5,6-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2C(=O)[C@H](C(=O)OC)[C@@H](c3ccccc3)N2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H22N2O7/c1-31-22(28)16-18(14-10-6-4-7-11-14)25-19(15-12-8-5-9-13-15)17(23(29)32-2)21(27)26(25)20(16)24(30)33-3/h4-13,17-19H,1-3H3/t17-,18+,19-/m1/s1 |
| InChIKey | IQLXTVDOXHYYLR-CEXWTWQISA-N |
| XLogP | 1.93 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|