C28H20Cl2FNO8 — CID 102012142
[(2R,3S,4R,5R,6S)-4-benzoyloxy-5-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-fluoro-2-(hydroxymethyl)oxan-3-yl] benzoate (PubChem CID 102012142) has the molecular formula C28H20Cl2FNO8 and a molecular weight of 588.37 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-4-benzoyloxy-5-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-fluoro-2-(hydroxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-4-benzoyloxy-5-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-fluoro-2-(hydroxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 102012142 |
| Molecular Formula | C28H20Cl2FNO8 |
| Molecular Weight | 588.37 g/mol |
| Exact Mass | 587.06 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4-benzoyloxy-5-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-fluoro-2-(hydroxymethyl)oxan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1[C@H](OC(=O)c2ccccc2)[C@@H](CO)O[C@@H](F)[C@@H]1N1C(=O)c2cc(Cl)c(Cl)cc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C28H20Cl2FNO8/c29-18-11-16-17(12-19(18)30)26(35)32(25(16)34)21-23(40-28(37)15-9-5-2-6-10-15)22(20(13-33)38-24(21)31)39-27(36)14-7-3-1-4-8-14/h1-12,20-24,33H,13H2/t20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | WVHYGSUQQFCJHR-MRKXFKPJSA-N |
| XLogP | 4.10 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|