C30H28ClNO7 — CID 56843367
[(2R,3S,4R,5R,6S)-6-chloro-5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate (PubChem CID 56843367) has the molecular formula C30H28ClNO7 and a molecular weight of 550.01 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-chloro-5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-chloro-5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 56843367 |
| Molecular Formula | C30H28ClNO7 |
| Molecular Weight | 550.01 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-chloro-5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OCc2ccccc2)[C@@H](N2C(=O)c3ccccc3C2=O)[C@H](Cl)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C30H28ClNO7/c1-19(33)38-26-24(18-36-16-20-10-4-2-5-11-20)39-28(31)25(27(26)37-17-21-12-6-3-7-13-21)32-29(34)22-14-8-9-15-23(22)30(32)35/h2-15,24-28H,16-18H2,1H3/t24-,25-,26-,27-,28-/m1/s1 |
| InChIKey | FOQZYFTUNIUXCP-JQPIIJRMSA-N |
| XLogP | 4.35 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.01 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|