C28H27NO7 — CID 15127032
2-[(3R,4R,5S,6R)-2,5-dihydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione (PubChem CID 15127032) has the molecular formula C28H27NO7 and a molecular weight of 489.52 g/mol. Its IUPAC name is 2-[(3R,4R,5S,6R)-2,5-dihydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3R,4R,5S,6R)-2,5-dihydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15127032 |
| Molecular Formula | C28H27NO7 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2-[(3R,4R,5S,6R)-2,5-dihydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@H]1C(O)O[C@H](COCc2ccccc2)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H27NO7/c30-24-22(17-34-15-18-9-3-1-4-10-18)36-28(33)23(25(24)35-16-19-11-5-2-6-12-19)29-26(31)20-13-7-8-14-21(20)27(29)32/h1-14,22-25,28,30,33H,15-17H2/t22-,23-,24-,25-,28?/m1/s1 |
| InChIKey | HQFUJXVCDCYIOI-RCIJNJJLSA-N |
| XLogP | 2.53 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|