C15H32O2Si — CID 102012577
tert-butyl-dimethyl-[(3R,4R)-3-methyloct-1-en-4-yl]peroxysilane (PubChem CID 102012577) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R,4R)-3-methyloct-1-en-4-yl]peroxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R,4R)-3-methyloct-1-en-4-yl]peroxysilane |
|---|---|
| PubChem CID | 102012577 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | tert-butyl-dimethyl-[(3R,4R)-3-methyloct-1-en-4-yl]peroxysilane |
| SMILES | C=C[C@@H](C)[C@@H](CCCC)OO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O2Si/c1-9-11-12-14(13(3)10-2)16-17-18(7,8)15(4,5)6/h10,13-14H,2,9,11-12H2,1,3-8H3/t13-,14-/m1/s1 |
| InChIKey | MPDLFYFRZDLRGO-ZIAGYGMSSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|