C42H38O6 — CID 102016344
[3-[[4-[(E)-2-[10-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]anthracen-9-yl]ethenyl]-2,6-dimethoxyphenoxy]methyl]phenyl]methanol (PubChem CID 102016344) has the molecular formula C42H38O6 and a molecular weight of 638.76 g/mol. Its IUPAC name is [3-[[4-[(E)-2-[10-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]anthracen-9-yl]ethenyl]-2,6-dimethoxyphenoxy]methyl]phenyl]methanol.
| Compound Name | [3-[[4-[(E)-2-[10-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]anthracen-9-yl]ethenyl]-2,6-dimethoxyphenoxy]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 102016344 |
| Molecular Formula | C42H38O6 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | [3-[[4-[(E)-2-[10-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]anthracen-9-yl]ethenyl]-2,6-dimethoxyphenoxy]methyl]phenyl]methanol |
| SMILES | COc1cc(/C=C/c2c3ccccc3c(/C=C/c3cc(OC)c(OCc4cccc(CO)c4)c(OC)c3)c3ccccc23)cc(OC)c1 |
| InChI | InChI=1S/C42H38O6/c1-44-32-21-28(22-33(25-32)45-2)16-18-38-34-12-5-7-14-36(34)39(37-15-8-6-13-35(37)38)19-17-29-23-40(46-3)42(41(24-29)47-4)48-27-31-11-9-10-30(20-31)26-43/h5-25,43H,26-27H2,1-4H3/b18-16+,19-17+ |
| InChIKey | WZCVOMXYAAUCOC-YWNVXTCZSA-N |
| XLogP | 9.44 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|