C26H29NO2 — CID 102018328
1-benzyl-4-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)quinolin-2-one (PubChem CID 102018328) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-benzyl-4-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)quinolin-2-one.
| Compound Name | 1-benzyl-4-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)quinolin-2-one |
|---|---|
| PubChem CID | 102018328 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-benzyl-4-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)quinolin-2-one |
| SMILES | CC(C)(C)C1=C(c2cc(=O)n(Cc3ccccc3)c3ccccc23)OCC1(C)C |
| InChI | InChI=1S/C26H29NO2/c1-25(2,3)24-23(29-17-26(24,4)5)20-15-22(28)27(16-18-11-7-6-8-12-18)21-14-10-9-13-19(20)21/h6-15H,16-17H2,1-5H3 |
| InChIKey | FHKFJUJLVYFJBK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |