C33H34BNO4 — CID 155936478
(3aS,4S,10aR)-9-benzyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3a,10,10a-tetrahydrofuro[3,4-b]carbazol-3-one (PubChem CID 155936478) has the molecular formula C33H34BNO4 and a molecular weight of 519.45 g/mol. Its IUPAC name is (3aS,4S,10aR)-9-benzyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3a,10,10a-tetrahydrofuro[3,4-b]carbazol-3-one.
| Compound Name | (3aS,4S,10aR)-9-benzyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3a,10,10a-tetrahydrofuro[3,4-b]carbazol-3-one |
|---|---|
| PubChem CID | 155936478 |
| Molecular Formula | C33H34BNO4 |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | (3aS,4S,10aR)-9-benzyl-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3a,10,10a-tetrahydrofuro[3,4-b]carbazol-3-one |
| SMILES | CC1(C)OB([C@]2(c3ccccc3)c3c(n(Cc4ccccc4)c4ccccc34)C[C@H]3COC(=O)[C@@H]32)OC1(C)C |
| InChI | InChI=1S/C33H34BNO4/c1-31(2)32(3,4)39-34(38-31)33(24-15-9-6-10-16-24)28-23(21-37-30(28)36)19-27-29(33)25-17-11-12-18-26(25)35(27)20-22-13-7-5-8-14-22/h5-18,23,28H,19-21H2,1-4H3/t23-,28+,33-/m0/s1 |
| InChIKey | NIYHUVQMWZULRT-NTNZYITJSA-N |
| XLogP | 5.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|