C39H39N3O4S2 — CID 102234141
9-benzyl-1',2-bis-(4-methylphenyl)sulfonylspiro[1,3-dihydropyrido[3,4-b]indole-4,2'-5,6,7,7a-tetrahydro-4H-indole] (PubChem CID 102234141) has the molecular formula C39H39N3O4S2 and a molecular weight of 677.89 g/mol. Its IUPAC name is 9-benzyl-1',2-bis-(4-methylphenyl)sulfonylspiro[1,3-dihydropyrido[3,4-b]indole-4,2'-5,6,7,7a-tetrahydro-4H-indole].
| Compound Name | 9-benzyl-1',2-bis-(4-methylphenyl)sulfonylspiro[1,3-dihydropyrido[3,4-b]indole-4,2'-5,6,7,7a-tetrahydro-4H-indole] |
|---|---|
| PubChem CID | 102234141 |
| Molecular Formula | C39H39N3O4S2 |
| Molecular Weight | 677.89 g/mol |
| Exact Mass | 677.24 |
| IUPAC Name | 9-benzyl-1',2-bis-(4-methylphenyl)sulfonylspiro[1,3-dihydropyrido[3,4-b]indole-4,2'-5,6,7,7a-tetrahydro-4H-indole] |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3c(c4ccccc4n3Cc3ccccc3)C3(C=C4CCCCC4N3S(=O)(=O)c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C39H39N3O4S2/c1-28-16-20-32(21-17-28)47(43,44)40-26-37-38(34-13-7-9-15-36(34)41(37)25-30-10-4-3-5-11-30)39(27-40)24-31-12-6-8-14-35(31)42(39)48(45,46)33-22-18-29(2)19-23-33/h3-5,7,9-11,13,15-24,35H,6,8,12,14,25-27H2,1-2H3 |
| InChIKey | VWFFGXYEYGLJAS-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.89 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|