C36H35N3O4S2 — CID 102234135
9-benzyl-3'-methyl-1',2-bis-(4-methylphenyl)sulfonylspiro[1,3-dihydropyrido[3,4-b]indole-4,5'-2H-pyrrole] (PubChem CID 102234135) has the molecular formula C36H35N3O4S2 and a molecular weight of 637.83 g/mol. Its IUPAC name is 9-benzyl-3'-methyl-1',2-bis-(4-methylphenyl)sulfonylspiro[1,3-dihydropyrido[3,4-b]indole-4,5'-2H-pyrrole].
| Compound Name | 9-benzyl-3'-methyl-1',2-bis-(4-methylphenyl)sulfonylspiro[1,3-dihydropyrido[3,4-b]indole-4,5'-2H-pyrrole] |
|---|---|
| PubChem CID | 102234135 |
| Molecular Formula | C36H35N3O4S2 |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.21 |
| IUPAC Name | 9-benzyl-3'-methyl-1',2-bis-(4-methylphenyl)sulfonylspiro[1,3-dihydropyrido[3,4-b]indole-4,5'-2H-pyrrole] |
| SMILES | CC1=CC2(CN(S(=O)(=O)c3ccc(C)cc3)Cc3c2c2ccccc2n3Cc2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C36H35N3O4S2/c1-26-13-17-30(18-14-26)44(40,41)37-24-34-35(32-11-7-8-12-33(32)38(34)23-29-9-5-4-6-10-29)36(25-37)21-28(3)22-39(36)45(42,43)31-19-15-27(2)16-20-31/h4-21H,22-25H2,1-3H3 |
| InChIKey | QKAOENCRQJVSKH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|