C26H29N3O2 — CID 10201954
2,2-dimethyl-N-[6-[4-(3-phenylpropylamino)phenoxy]-3-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 10201954) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2,2-dimethyl-N-[6-[4-(3-phenylpropylamino)phenoxy]-3-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dimethyl-N-[6-[4-(3-phenylpropylamino)phenoxy]-3-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 10201954 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2,2-dimethyl-N-[6-[4-(3-phenylpropylamino)phenoxy]-3-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | CC1(C)CC1C(=O)Nc1ccc(Oc2ccc(NCCCc3ccccc3)cc2)nc1 |
| InChI | InChI=1S/C26H29N3O2/c1-26(2)17-23(26)25(30)29-21-12-15-24(28-18-21)31-22-13-10-20(11-14-22)27-16-6-9-19-7-4-3-5-8-19/h3-5,7-8,10-15,18,23,27H,6,9,16-17H2,1-2H3,(H,29,30) |
| InChIKey | PVBPIDGWOYJNFK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|