C27H30N4O3 — CID 143176119
N-[6-[4-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]phenoxy]-3-pyridinyl]acetamide (PubChem CID 143176119) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is N-[6-[4-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]phenoxy]-3-pyridinyl]acetamide.
| Compound Name | N-[6-[4-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]phenoxy]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 143176119 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | N-[6-[4-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]phenoxy]-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Oc2ccc(CCC(=O)N3CCN(Cc4ccccc4)CC3)cc2)nc1 |
| InChI | InChI=1S/C27H30N4O3/c1-21(32)29-24-10-13-26(28-19-24)34-25-11-7-22(8-12-25)9-14-27(33)31-17-15-30(16-18-31)20-23-5-3-2-4-6-23/h2-8,10-13,19H,9,14-18,20H2,1H3,(H,29,32) |
| InChIKey | QPKVIKYEFPPURL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |