C39H40N4O2 — CID 68524311
1-(4-benzylpiperazin-1-yl)-3-[4-[[5-(dibenzylamino)-2-pyridinyl]oxy]phenyl]propan-1-one (PubChem CID 68524311) has the molecular formula C39H40N4O2 and a molecular weight of 596.78 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-[4-[[5-(dibenzylamino)-2-pyridinyl]oxy]phenyl]propan-1-one.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-[4-[[5-(dibenzylamino)-2-pyridinyl]oxy]phenyl]propan-1-one |
|---|---|
| PubChem CID | 68524311 |
| Molecular Formula | C39H40N4O2 |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-[4-[[5-(dibenzylamino)-2-pyridinyl]oxy]phenyl]propan-1-one |
| SMILES | O=C(CCc1ccc(Oc2ccc(N(Cc3ccccc3)Cc3ccccc3)cn2)cc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C39H40N4O2/c44-39(42-26-24-41(25-27-42)29-33-10-4-1-5-11-33)23-18-32-16-20-37(21-17-32)45-38-22-19-36(28-40-38)43(30-34-12-6-2-7-13-34)31-35-14-8-3-9-15-35/h1-17,19-22,28H,18,23-27,29-31H2 |
| InChIKey | FBLSCPXKRCSENB-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |