C29H34N4O2 — CID 141132254
1-(4-benzylpiperazin-1-yl)-2-[1-(4-pyridin-2-yloxyphenyl)piperidin-4-yl]ethanone (PubChem CID 141132254) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-[1-(4-pyridin-2-yloxyphenyl)piperidin-4-yl]ethanone.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-[1-(4-pyridin-2-yloxyphenyl)piperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 141132254 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-[1-(4-pyridin-2-yloxyphenyl)piperidin-4-yl]ethanone |
| SMILES | O=C(CC1CCN(c2ccc(Oc3ccccn3)cc2)CC1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H34N4O2/c34-29(33-20-18-31(19-21-33)23-25-6-2-1-3-7-25)22-24-13-16-32(17-14-24)26-9-11-27(12-10-26)35-28-8-4-5-15-30-28/h1-12,15,24H,13-14,16-23H2 |
| InChIKey | MNTPJUIFFULURM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |