C24H32N2O3Si2 — CID 102021528
[4-[3-[[3-(4-cyanatophenyl)propyl-dimethylsilyl]oxy-dimethylsilyl]propyl]phenyl] cyanate (PubChem CID 102021528) has the molecular formula C24H32N2O3Si2 and a molecular weight of 452.70 g/mol. Its IUPAC name is [4-[3-[[3-(4-cyanatophenyl)propyl-dimethylsilyl]oxy-dimethylsilyl]propyl]phenyl] cyanate.
| Compound Name | [4-[3-[[3-(4-cyanatophenyl)propyl-dimethylsilyl]oxy-dimethylsilyl]propyl]phenyl] cyanate |
|---|---|
| PubChem CID | 102021528 |
| Molecular Formula | C24H32N2O3Si2 |
| Molecular Weight | 452.70 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [4-[3-[[3-(4-cyanatophenyl)propyl-dimethylsilyl]oxy-dimethylsilyl]propyl]phenyl] cyanate |
| SMILES | C[Si](C)(CCCc1ccc(OC#N)cc1)O[Si](C)(C)CCCc1ccc(OC#N)cc1 |
| InChI | InChI=1S/C24H32N2O3Si2/c1-30(2,17-5-7-21-9-13-23(14-10-21)27-19-25)29-31(3,4)18-6-8-22-11-15-24(16-12-22)28-20-26/h9-16H,5-8,17-18H2,1-4H3 |
| InChIKey | YPLMCBLFJJCPSJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|