C24H28O8 — CID 102023275
[(3S,4S)-3,4-bis[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl] acetate (PubChem CID 102023275) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is [(3S,4S)-3,4-bis[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl] acetate.
| Compound Name | [(3S,4S)-3,4-bis[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 102023275 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [(3S,4S)-3,4-bis[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl] acetate |
| SMILES | COc1ccc(C[C@H]2COC(=O)[C@@]2(Cc2ccc(OC)c(OC)c2)OC(C)=O)cc1OC |
| InChI | InChI=1S/C24H28O8/c1-15(25)32-24(13-17-7-9-20(28-3)22(12-17)30-5)18(14-31-23(24)26)10-16-6-8-19(27-2)21(11-16)29-4/h6-9,11-12,18H,10,13-14H2,1-5H3/t18-,24-/m0/s1 |
| InChIKey | NPBCPNXLLFVLDR-UUOWRZLLSA-N |
| XLogP | 2.98 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |