C26H28O8 — CID 162906932
[(3S,4S)-3-(1,3-benzodioxol-5-ylmethyl)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl] 2-methylbut-2-enoate (PubChem CID 162906932) has the molecular formula C26H28O8 and a molecular weight of 468.50 g/mol. Its IUPAC name is [(3S,4S)-3-(1,3-benzodioxol-5-ylmethyl)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl] 2-methylbut-2-enoate.
| Compound Name | [(3S,4S)-3-(1,3-benzodioxol-5-ylmethyl)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162906932 |
| Molecular Formula | C26H28O8 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [(3S,4S)-3-(1,3-benzodioxol-5-ylmethyl)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@]1(Cc2ccc3c(c2)OCO3)C(=O)OC[C@@H]1Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H28O8/c1-5-16(2)24(27)34-26(13-18-7-9-21-23(12-18)33-15-32-21)19(14-31-25(26)28)10-17-6-8-20(29-3)22(11-17)30-4/h5-9,11-12,19H,10,13-15H2,1-4H3/t19-,26-/m0/s1 |
| InChIKey | NXAKWBMWSGBSNY-SIBVEZHUSA-N |
| XLogP | 3.64 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|