About [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate
[(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate (PubChem CID 102026032) has the molecular formula C6H9N3O3
and a molecular weight of 171.16 g/mol. Its IUPAC name is [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate.
Molecular Properties
| Compound Name | [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate |
| PubChem CID | 102026032 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate |
| SMILES | C[C@@H](C=O)[C@@H](CN=[N+]=[N-])OC=O |
| InChI | InChI=1S/C6H9N3O3/c1-5(3-10)6(12-4-11)2-8-9-7/h3-6H,2H2,1H3/t5-,6+/m0/s1 |
| InChIKey | YGQYAIPBIRHIFA-NTSWFWBYSA-N |
| XLogP | 0.67 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate?
The IUPAC name of [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate (CID 102026032) is [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate.
What is the SMILES notation for [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate?
The canonical SMILES for [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate is C[C@@H](C=O)[C@@H](CN=[N+]=[N-])OC=O.
What is the InChIKey of [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate?
The InChIKey is YGQYAIPBIRHIFA-NTSWFWBYSA-N. The full InChI is InChI=1S/C6H9N3O3/c1-5(3-10)6(12-4-11)2-8-9-7/h3-6H,2H2,1H3/t5-,6+/m0/s1.
What are the key properties of [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate?
[(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate has a molecular weight of 171.16 g/mol, XLogP of 0.67, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-1-azido-3-methyl-4-oxobutan-2-yl] formate is sourced from PubChem (CID 102026032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).