C30H43O6P — CID 102026642
4-[(E)-2-[4-(dimethoxyphosphorylmethyl)-2,5-dihexoxyphenyl]ethenyl]benzaldehyde (PubChem CID 102026642) has the molecular formula C30H43O6P and a molecular weight of 530.64 g/mol. Its IUPAC name is 4-[(E)-2-[4-(dimethoxyphosphorylmethyl)-2,5-dihexoxyphenyl]ethenyl]benzaldehyde.
| Compound Name | 4-[(E)-2-[4-(dimethoxyphosphorylmethyl)-2,5-dihexoxyphenyl]ethenyl]benzaldehyde |
|---|---|
| PubChem CID | 102026642 |
| Molecular Formula | C30H43O6P |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 4-[(E)-2-[4-(dimethoxyphosphorylmethyl)-2,5-dihexoxyphenyl]ethenyl]benzaldehyde |
| SMILES | CCCCCCOc1cc(CP(=O)(OC)OC)c(OCCCCCC)cc1/C=C/c1ccc(C=O)cc1 |
| InChI | InChI=1S/C30H43O6P/c1-5-7-9-11-19-35-29-22-28(24-37(32,33-3)34-4)30(36-20-12-10-8-6-2)21-27(29)18-17-25-13-15-26(23-31)16-14-25/h13-18,21-23H,5-12,19-20,24H2,1-4H3/b18-17+ |
| InChIKey | BQVLLFHHKMMTRJ-ISLYRVAYSA-N |
| XLogP | 8.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|