C20H28N6S2 — CID 102026983
4-amino-3-[[2-amino-5-(N'-propan-2-ylcarbamimidoyl)phenyl]disulfanyl]-N'-propan-2-ylbenzenecarboximidamide (PubChem CID 102026983) has the molecular formula C20H28N6S2 and a molecular weight of 416.62 g/mol. Its IUPAC name is 4-amino-3-[[2-amino-5-(N'-propan-2-ylcarbamimidoyl)phenyl]disulfanyl]-N'-propan-2-ylbenzenecarboximidamide.
| Compound Name | 4-amino-3-[[2-amino-5-(N'-propan-2-ylcarbamimidoyl)phenyl]disulfanyl]-N'-propan-2-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 102026983 |
| Molecular Formula | C20H28N6S2 |
| Molecular Weight | 416.62 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-amino-3-[[2-amino-5-(N'-propan-2-ylcarbamimidoyl)phenyl]disulfanyl]-N'-propan-2-ylbenzenecarboximidamide |
| SMILES | CC(C)/N=C(\N)c1ccc(N)c(SSc2cc(/C(N)=N/C(C)C)ccc2N)c1 |
| InChI | InChI=1S/C20H28N6S2/c1-11(2)25-19(23)13-5-7-15(21)17(9-13)27-28-18-10-14(6-8-16(18)22)20(24)26-12(3)4/h5-12H,21-22H2,1-4H3,(H2,23,25)(H2,24,26) |
| InChIKey | GBOUNTYXOJFGKH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|