C14H20N2O6 — CID 102027240
tert-butyl (4Z)-4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2,5-dioxoimidazolidine-1-carboxylate (PubChem CID 102027240) has the molecular formula C14H20N2O6 and a molecular weight of 312.32 g/mol. Its IUPAC name is tert-butyl (4Z)-4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2,5-dioxoimidazolidine-1-carboxylate.
| Compound Name | tert-butyl (4Z)-4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2,5-dioxoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 102027240 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | tert-butyl (4Z)-4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2,5-dioxoimidazolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)N/C(=C\[C@H]2COC(C)(C)O2)C1=O |
| InChI | InChI=1S/C14H20N2O6/c1-13(2,3)22-12(19)16-10(17)9(15-11(16)18)6-8-7-20-14(4,5)21-8/h6,8H,7H2,1-5H3,(H,15,18)/b9-6-/t8-/m0/s1 |
| InChIKey | CGFYTOTWASZMJR-HWPCKVLBSA-N |
| XLogP | 1.51 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|