C20H32O4 — CID 102028538
ethyl (2S,3R)-2-[(1Z,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-3-methyl-1,4-dioxaspiro[4.4]nonane-3-carboxylate (PubChem CID 102028538) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is ethyl (2S,3R)-2-[(1Z,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-3-methyl-1,4-dioxaspiro[4.4]nonane-3-carboxylate.
| Compound Name | ethyl (2S,3R)-2-[(1Z,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-3-methyl-1,4-dioxaspiro[4.4]nonane-3-carboxylate |
|---|---|
| PubChem CID | 102028538 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | ethyl (2S,3R)-2-[(1Z,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-3-methyl-1,4-dioxaspiro[4.4]nonane-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)OC2(CCCC2)O[C@H]1/C=C\C(C)=C\[C@@H](C)CC |
| InChI | InChI=1S/C20H32O4/c1-6-15(3)14-16(4)10-11-17-19(5,18(21)22-7-2)24-20(23-17)12-8-9-13-20/h10-11,14-15,17H,6-9,12-13H2,1-5H3/b11-10-,16-14+/t15-,17-,19+/m0/s1 |
| InChIKey | JASCOVUZFTTYKU-IQQBUSDISA-N |
| XLogP | 4.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|