C24H19ClF2O3 — CID 10202868
3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid (PubChem CID 10202868) has the molecular formula C24H19ClF2O3 and a molecular weight of 428.86 g/mol. Its IUPAC name is 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid.
| Compound Name | 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid |
|---|---|
| PubChem CID | 10202868 |
| Molecular Formula | C24H19ClF2O3 |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCC=C(c2ccc(F)cc2)c2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C24H19ClF2O3/c25-22-15-16(2-12-24(28)29)1-11-23(22)30-14-13-21(17-3-7-19(26)8-4-17)18-5-9-20(27)10-6-18/h1,3-11,13,15H,2,12,14H2,(H,28,29) |
| InChIKey | XVFYDSIKVHRWQD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |