About 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid
3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid (PubChem CID 10202868) has the molecular formula C24H19ClF2O3
and a molecular weight of 428.86 g/mol. Its IUPAC name is 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid |
| PubChem CID | 10202868 |
| Molecular Formula | C24H19ClF2O3 |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCC=C(c2ccc(F)cc2)c2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C24H19ClF2O3/c25-22-15-16(2-12-24(28)29)1-11-23(22)30-14-13-21(17-3-7-19(26)8-4-17)18-5-9-20(27)10-6-18/h1,3-11,13,15H,2,12,14H2,(H,28,29) |
| InChIKey | XVFYDSIKVHRWQD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid?
The IUPAC name of 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid (CID 10202868) is 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid.
What is the SMILES notation for 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid?
The canonical SMILES for 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid is O=C(O)CCc1ccc(OCC=C(c2ccc(F)cc2)c2ccc(F)cc2)c(Cl)c1.
What is the InChIKey of 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid?
The InChIKey is XVFYDSIKVHRWQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19ClF2O3/c25-22-15-16(2-12-24(28)29)1-11-23(22)30-14-13-21(17-3-7-19(26)8-4-17)18-5-9-20(27)10-6-18/h1,3-11,13,15H,2,12,14H2,(H,28,29).
What are the key properties of 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid?
3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid has a molecular weight of 428.86 g/mol, XLogP of 6.15, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[3,3-bis(4-fluorophenyl)prop-2-enoxy]-3-chlorophenyl]propanoic acid is sourced from PubChem (CID 10202868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).