C34H40N2O7Si — CID 102029542
benzyl (4aS,8S,8aS,9S)-4a-[tert-butyl(dimethyl)silyl]oxy-9-(dimethylamino)-4,5-dioxo-3-phenylmethoxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-8-carboxylate (PubChem CID 102029542) has the molecular formula C34H40N2O7Si and a molecular weight of 616.79 g/mol. Its IUPAC name is benzyl (4aS,8S,8aS,9S)-4a-[tert-butyl(dimethyl)silyl]oxy-9-(dimethylamino)-4,5-dioxo-3-phenylmethoxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-8-carboxylate.
| Compound Name | benzyl (4aS,8S,8aS,9S)-4a-[tert-butyl(dimethyl)silyl]oxy-9-(dimethylamino)-4,5-dioxo-3-phenylmethoxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-8-carboxylate |
|---|---|
| PubChem CID | 102029542 |
| Molecular Formula | C34H40N2O7Si |
| Molecular Weight | 616.79 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | benzyl (4aS,8S,8aS,9S)-4a-[tert-butyl(dimethyl)silyl]oxy-9-(dimethylamino)-4,5-dioxo-3-phenylmethoxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-8-carboxylate |
| SMILES | CN(C)[C@@H]1c2onc(OCc3ccccc3)c2C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(=O)C=C[C@H](C(=O)OCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C34H40N2O7Si/c1-33(2,3)44(6,7)43-34-25(37)19-18-24(32(39)41-21-23-16-12-9-13-17-23)27(34)28(36(4)5)29-26(30(34)38)31(35-42-29)40-20-22-14-10-8-11-15-22/h8-19,24,27-28H,20-21H2,1-7H3/t24-,27-,28-,34+/m0/s1 |
| InChIKey | CKLPCMNKPUMNSP-UCZUQDLNSA-N |
| XLogP | 5.93 |
| TPSA | 108.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.79 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|