C22H23NO5 — CID 91062915
4a-methoxy-3-phenylmethoxy-9-propan-2-yl-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione (PubChem CID 91062915) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4a-methoxy-3-phenylmethoxy-9-propan-2-yl-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione.
| Compound Name | 4a-methoxy-3-phenylmethoxy-9-propan-2-yl-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione |
|---|---|
| PubChem CID | 91062915 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4a-methoxy-3-phenylmethoxy-9-propan-2-yl-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione |
| SMILES | COC12C(=O)C=CCC1C(C(C)C)c1onc(OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C22H23NO5/c1-13(2)17-15-10-7-11-16(24)22(15,26-3)20(25)18-19(17)28-23-21(18)27-12-14-8-5-4-6-9-14/h4-9,11,13,15,17H,10,12H2,1-3H3 |
| InChIKey | BEGUZXVOILANEA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|