C21H22N2O5 — CID 126602920
(4aS,8aS)-9-(dimethylamino)-4a-hydroxy-9-methyl-3-phenylmethoxy-8,8a-dihydrobenzo[f][1,2]benzoxazole-4,5-dione (PubChem CID 126602920) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (4aS,8aS)-9-(dimethylamino)-4a-hydroxy-9-methyl-3-phenylmethoxy-8,8a-dihydrobenzo[f][1,2]benzoxazole-4,5-dione.
| Compound Name | (4aS,8aS)-9-(dimethylamino)-4a-hydroxy-9-methyl-3-phenylmethoxy-8,8a-dihydrobenzo[f][1,2]benzoxazole-4,5-dione |
|---|---|
| PubChem CID | 126602920 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (4aS,8aS)-9-(dimethylamino)-4a-hydroxy-9-methyl-3-phenylmethoxy-8,8a-dihydrobenzo[f][1,2]benzoxazole-4,5-dione |
| SMILES | CN(C)C1(C)c2onc(OCc3ccccc3)c2C(=O)[C@@]2(O)C(=O)C=CC[C@@H]12 |
| InChI | InChI=1S/C21H22N2O5/c1-20(23(2)3)14-10-7-11-15(24)21(14,26)17(25)16-18(20)28-22-19(16)27-12-13-8-5-4-6-9-13/h4-9,11,14,26H,10,12H2,1-3H3/t14-,20?,21-/m0/s1 |
| InChIKey | DJVPBMLXMGQCOS-YZIZEKMBSA-N |
| XLogP | 2.10 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|