C20H21N2O5P — CID 59512766
(4aS,8aS,9S)-9-(dimethylamino)-3-phenylmethoxy-4a-phosphanyloxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione (PubChem CID 59512766) has the molecular formula C20H21N2O5P and a molecular weight of 400.37 g/mol. Its IUPAC name is (4aS,8aS,9S)-9-(dimethylamino)-3-phenylmethoxy-4a-phosphanyloxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione.
| Compound Name | (4aS,8aS,9S)-9-(dimethylamino)-3-phenylmethoxy-4a-phosphanyloxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione |
|---|---|
| PubChem CID | 59512766 |
| Molecular Formula | C20H21N2O5P |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (4aS,8aS,9S)-9-(dimethylamino)-3-phenylmethoxy-4a-phosphanyloxy-8a,9-dihydro-8H-benzo[f][1,2]benzoxazole-4,5-dione |
| SMILES | CN(C)[C@@H]1c2onc(OCc3ccccc3)c2C(=O)[C@@]2(OP)C(=O)C=CC[C@@H]12 |
| InChI | InChI=1S/C20H21N2O5P/c1-22(2)16-13-9-6-10-14(23)20(13,27-28)18(24)15-17(16)26-21-19(15)25-11-12-7-4-3-5-8-12/h3-8,10,13,16H,9,11,28H2,1-2H3/t13-,16-,20-/m0/s1 |
| InChIKey | JEELVUFZWQTTFY-RISOHXOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|