C37H36N2O7 — CID 91513703
17-(dimethylamino)-24-methoxy-4-methyl-21-phenylmethoxy-11-prop-2-enoxy-19-oxa-20-azahexacyclo[12.11.0.03,12.05,10.016,24.018,22]pentacosa-3,5,7,9,11,18(22),20-heptaene-2,23,25-trione (PubChem CID 91513703) has the molecular formula C37H36N2O7 and a molecular weight of 620.70 g/mol. Its IUPAC name is 17-(dimethylamino)-24-methoxy-4-methyl-21-phenylmethoxy-11-prop-2-enoxy-19-oxa-20-azahexacyclo[12.11.0.03,12.05,10.016,24.018,22]pentacosa-3,5,7,9,11,18(22),20-heptaene-2,23,25-trione.
| Compound Name | 17-(dimethylamino)-24-methoxy-4-methyl-21-phenylmethoxy-11-prop-2-enoxy-19-oxa-20-azahexacyclo[12.11.0.03,12.05,10.016,24.018,22]pentacosa-3,5,7,9,11,18(22),20-heptaene-2,23,25-trione |
|---|---|
| PubChem CID | 91513703 |
| Molecular Formula | C37H36N2O7 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | 17-(dimethylamino)-24-methoxy-4-methyl-21-phenylmethoxy-11-prop-2-enoxy-19-oxa-20-azahexacyclo[12.11.0.03,12.05,10.016,24.018,22]pentacosa-3,5,7,9,11,18(22),20-heptaene-2,23,25-trione |
| SMILES | C=CCOc1c2c(c(C)c3ccccc13)C(=O)C1C(=O)C3(OC)C(=O)c4c(OCc5ccccc5)noc4C(N(C)C)C3CC1C2 |
| InChI | InChI=1S/C37H36N2O7/c1-6-16-44-32-24-15-11-10-14-23(24)20(2)27-25(32)17-22-18-26-30(39(3)4)33-29(35(42)37(26,43-5)34(41)28(22)31(27)40)36(38-46-33)45-19-21-12-8-7-9-13-21/h6-15,22,26,28,30H,1,16-19H2,2-5H3 |
| InChIKey | LUAYBXMUDCBRQS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 108.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|