C34H40N4O6 — CID 90747867
4,19-bis(dimethylamino)-11-methoxy-8-methyl-18-(methylaminomethyl)-16-phenylmethoxy-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,15,17,19-pentaene-10,12,14-trione (PubChem CID 90747867) has the molecular formula C34H40N4O6 and a molecular weight of 600.72 g/mol. Its IUPAC name is 4,19-bis(dimethylamino)-11-methoxy-8-methyl-18-(methylaminomethyl)-16-phenylmethoxy-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,15,17,19-pentaene-10,12,14-trione.
| Compound Name | 4,19-bis(dimethylamino)-11-methoxy-8-methyl-18-(methylaminomethyl)-16-phenylmethoxy-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,15,17,19-pentaene-10,12,14-trione |
|---|---|
| PubChem CID | 90747867 |
| Molecular Formula | C34H40N4O6 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 4,19-bis(dimethylamino)-11-methoxy-8-methyl-18-(methylaminomethyl)-16-phenylmethoxy-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,15,17,19-pentaene-10,12,14-trione |
| SMILES | CNCc1cc(OCc2ccccc2)c2c(c1N(C)C)CC1CC3C(N(C)C)c4onc(C)c4C(=O)C3(OC)C(=O)C1C2=O |
| InChI | InChI=1S/C34H40N4O6/c1-18-25-31(44-36-18)29(38(5)6)23-14-20-13-22-27(30(39)26(20)33(41)34(23,42-7)32(25)40)24(43-17-19-11-9-8-10-12-19)15-21(16-35-2)28(22)37(3)4/h8-12,15,20,23,26,29,35H,13-14,16-17H2,1-7H3 |
| InChIKey | HNGOQTILGXDJJW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 114.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|