C35H33FN2O6 — CID 91180564
17-(dimethylamino)-7-fluoro-11-methoxy-4,24-dimethyl-21-phenylmethoxy-19-oxa-20-azahexacyclo[12.11.0.03,12.05,10.016,24.018,22]pentacosa-3(12),4,6,8,10,18(22),20-heptaene-2,23,25-trione (PubChem CID 91180564) has the molecular formula C35H33FN2O6 and a molecular weight of 596.66 g/mol. Its IUPAC name is 17-(dimethylamino)-7-fluoro-11-methoxy-4,24-dimethyl-21-phenylmethoxy-19-oxa-20-azahexacyclo[12.11.0.03,12.05,10.016,24.018,22]pentacosa-3(12),4,6,8,10,18(22),20-heptaene-2,23,25-trione.
| Compound Name | 17-(dimethylamino)-7-fluoro-11-methoxy-4,24-dimethyl-21-phenylmethoxy-19-oxa-20-azahexacyclo[12.11.0.03,12.05,10.016,24.018,22]pentacosa-3(12),4,6,8,10,18(22),20-heptaene-2,23,25-trione |
|---|---|
| PubChem CID | 91180564 |
| Molecular Formula | C35H33FN2O6 |
| Molecular Weight | 596.66 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 17-(dimethylamino)-7-fluoro-11-methoxy-4,24-dimethyl-21-phenylmethoxy-19-oxa-20-azahexacyclo[12.11.0.03,12.05,10.016,24.018,22]pentacosa-3(12),4,6,8,10,18(22),20-heptaene-2,23,25-trione |
| SMILES | COc1c2c(c(C)c3cc(F)ccc13)C(=O)C1C(=O)C3(C)C(=O)c4c(OCc5ccccc5)noc4C(N(C)C)C3CC1C2 |
| InChI | InChI=1S/C35H33FN2O6/c1-17-22-15-20(36)11-12-21(22)30(42-5)23-13-19-14-24-28(38(3)4)31-27(34(37-44-31)43-16-18-9-7-6-8-10-18)33(41)35(24,2)32(40)26(19)29(39)25(17)23/h6-12,15,19,24,26,28H,13-14,16H2,1-5H3 |
| InChIKey | VOEYYLJGCORUOH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.66 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|