C21H27N3O4 — CID 143142291
cyclohex-3-en-1-yl-[5-[(dimethylamino)methyl]-3-phenylmethoxy-1,2-oxazol-4-yl]methanone;nitrosomethane (PubChem CID 143142291) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-[5-[(dimethylamino)methyl]-3-phenylmethoxy-1,2-oxazol-4-yl]methanone;nitrosomethane.
| Compound Name | cyclohex-3-en-1-yl-[5-[(dimethylamino)methyl]-3-phenylmethoxy-1,2-oxazol-4-yl]methanone;nitrosomethane |
|---|---|
| PubChem CID | 143142291 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | cyclohex-3-en-1-yl-[5-[(dimethylamino)methyl]-3-phenylmethoxy-1,2-oxazol-4-yl]methanone;nitrosomethane |
| SMILES | CN(C)Cc1onc(OCc2ccccc2)c1C(=O)C1CC=CCC1.CN=O |
| InChI | InChI=1S/C20H24N2O3.CH3NO/c1-22(2)13-17-18(19(23)16-11-7-4-8-12-16)20(21-25-17)24-14-15-9-5-3-6-10-15;1-2-3/h3-7,9-10,16H,8,11-14H2,1-2H3;1H3 |
| InChIKey | DRBLMZMKXZGWAQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 85.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|