C32H40N2O6SSi — CID 59512777
(4aS,5S,6R,8aS,9S)-6-(benzenesulfinyl)-5-[tert-butyl(dimethyl)silyl]oxy-9-(dimethylamino)-4a-hydroxy-3-phenylmethoxy-5,6,8a,9-tetrahydrobenzo[f][1,2]benzoxazol-4-one (PubChem CID 59512777) has the molecular formula C32H40N2O6SSi and a molecular weight of 608.83 g/mol. Its IUPAC name is (4aS,5S,6R,8aS,9S)-6-(benzenesulfinyl)-5-[tert-butyl(dimethyl)silyl]oxy-9-(dimethylamino)-4a-hydroxy-3-phenylmethoxy-5,6,8a,9-tetrahydrobenzo[f][1,2]benzoxazol-4-one.
| Compound Name | (4aS,5S,6R,8aS,9S)-6-(benzenesulfinyl)-5-[tert-butyl(dimethyl)silyl]oxy-9-(dimethylamino)-4a-hydroxy-3-phenylmethoxy-5,6,8a,9-tetrahydrobenzo[f][1,2]benzoxazol-4-one |
|---|---|
| PubChem CID | 59512777 |
| Molecular Formula | C32H40N2O6SSi |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | (4aS,5S,6R,8aS,9S)-6-(benzenesulfinyl)-5-[tert-butyl(dimethyl)silyl]oxy-9-(dimethylamino)-4a-hydroxy-3-phenylmethoxy-5,6,8a,9-tetrahydrobenzo[f][1,2]benzoxazol-4-one |
| SMILES | CN(C)[C@@H]1c2onc(OCc3ccccc3)c2C(=O)[C@@]2(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](S(=O)c3ccccc3)C=C[C@@H]12 |
| InChI | InChI=1S/C32H40N2O6SSi/c1-31(2,3)42(6,7)40-29-24(41(37)22-16-12-9-13-17-22)19-18-23-26(34(4)5)27-25(28(35)32(23,29)36)30(33-39-27)38-20-21-14-10-8-11-15-21/h8-19,23-24,26,29,36H,20H2,1-7H3/t23-,24+,26-,29+,32+,41?/m0/s1 |
| InChIKey | PJTXSRMUPPQRPJ-IOGWGNCNSA-N |
| XLogP | 5.54 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|