C27H26N2O6S — CID 102032258
cyclohexyl 2-naphthalen-1-yl-1-(4-nitrophenyl)sulfonyl-2,5-dihydropyrrole-3-carboxylate (PubChem CID 102032258) has the molecular formula C27H26N2O6S and a molecular weight of 506.58 g/mol. Its IUPAC name is cyclohexyl 2-naphthalen-1-yl-1-(4-nitrophenyl)sulfonyl-2,5-dihydropyrrole-3-carboxylate.
| Compound Name | cyclohexyl 2-naphthalen-1-yl-1-(4-nitrophenyl)sulfonyl-2,5-dihydropyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102032258 |
| Molecular Formula | C27H26N2O6S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | cyclohexyl 2-naphthalen-1-yl-1-(4-nitrophenyl)sulfonyl-2,5-dihydropyrrole-3-carboxylate |
| SMILES | O=C(OC1CCCCC1)C1=CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1c1cccc2ccccc12 |
| InChI | InChI=1S/C27H26N2O6S/c30-27(35-21-9-2-1-3-10-21)25-17-18-28(36(33,34)22-15-13-20(14-16-22)29(31)32)26(25)24-12-6-8-19-7-4-5-11-23(19)24/h4-8,11-17,21,26H,1-3,9-10,18H2 |
| InChIKey | GEGAOJWEBRPWDC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|