C28H31N3O6S2 — CID 102034900
methyl (2S)-4-methylsulfanyl-2-[(10R,15S)-14-oxo-12-sulfanylidene-10-(3,4,5-trimethoxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]butanoate (PubChem CID 102034900) has the molecular formula C28H31N3O6S2 and a molecular weight of 569.71 g/mol. Its IUPAC name is methyl (2S)-4-methylsulfanyl-2-[(10R,15S)-14-oxo-12-sulfanylidene-10-(3,4,5-trimethoxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]butanoate.
| Compound Name | methyl (2S)-4-methylsulfanyl-2-[(10R,15S)-14-oxo-12-sulfanylidene-10-(3,4,5-trimethoxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]butanoate |
|---|---|
| PubChem CID | 102034900 |
| Molecular Formula | C28H31N3O6S2 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | methyl (2S)-4-methylsulfanyl-2-[(10R,15S)-14-oxo-12-sulfanylidene-10-(3,4,5-trimethoxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]butanoate |
| SMILES | COC(=O)[C@H](CCSC)N1C(=O)[C@@H]2Cc3c([nH]c4ccccc34)[C@@H](c3cc(OC)c(OC)c(OC)c3)N2C1=S |
| InChI | InChI=1S/C28H31N3O6S2/c1-34-21-12-15(13-22(35-2)25(21)36-3)24-23-17(16-8-6-7-9-18(16)29-23)14-20-26(32)31(28(38)30(20)24)19(10-11-39-5)27(33)37-4/h6-9,12-13,19-20,24,29H,10-11,14H2,1-5H3/t19-,20-,24+/m0/s1 |
| InChIKey | CEFKMUKTIWZEPF-MZLICYQSSA-N |
| XLogP | 3.93 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|