C11H21NO2S — CID 102035360
N-[(1S,2S,5S)-2-methyl-5-prop-1-en-2-ylcyclohexyl]methanesulfonamide (PubChem CID 102035360) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is N-[(1S,2S,5S)-2-methyl-5-prop-1-en-2-ylcyclohexyl]methanesulfonamide.
| Compound Name | N-[(1S,2S,5S)-2-methyl-5-prop-1-en-2-ylcyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 102035360 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-[(1S,2S,5S)-2-methyl-5-prop-1-en-2-ylcyclohexyl]methanesulfonamide |
| SMILES | C=C(C)[C@H]1CC[C@H](C)[C@@H](NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H21NO2S/c1-8(2)10-6-5-9(3)11(7-10)12-15(4,13)14/h9-12H,1,5-7H2,2-4H3/t9-,10-,11-/m0/s1 |
| InChIKey | NZIJBGMLNKJVMD-DCAQKATOSA-N |
| XLogP | 1.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|