C20H17N — CID 102035886
3-[cyclopenta-2,4-dien-1-yl(phenyl)methyl]-1H-indole (PubChem CID 102035886) has the molecular formula C20H17N and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-[cyclopenta-2,4-dien-1-yl(phenyl)methyl]-1H-indole.
| Compound Name | 3-[cyclopenta-2,4-dien-1-yl(phenyl)methyl]-1H-indole |
|---|---|
| PubChem CID | 102035886 |
| Molecular Formula | C20H17N |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-[cyclopenta-2,4-dien-1-yl(phenyl)methyl]-1H-indole |
| SMILES | C1=CC(C(c2ccccc2)c2c[nH]c3ccccc23)C=C1 |
| InChI | InChI=1S/C20H17N/c1-2-8-15(9-3-1)20(16-10-4-5-11-16)18-14-21-19-13-7-6-12-17(18)19/h1-14,16,20-21H |
| InChIKey | UFASKOFHWHSEST-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |