C24H17NO2 — CID 129384522
2-[(S)-1H-indol-3-yl(phenyl)methyl]indene-1,3-dione (PubChem CID 129384522) has the molecular formula C24H17NO2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[(S)-1H-indol-3-yl(phenyl)methyl]indene-1,3-dione.
| Compound Name | 2-[(S)-1H-indol-3-yl(phenyl)methyl]indene-1,3-dione |
|---|---|
| PubChem CID | 129384522 |
| Molecular Formula | C24H17NO2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[(S)-1H-indol-3-yl(phenyl)methyl]indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1[C@@H](c1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H17NO2/c26-23-17-11-4-5-12-18(17)24(27)22(23)21(15-8-2-1-3-9-15)19-14-25-20-13-7-6-10-16(19)20/h1-14,21-22,25H/t21-/m0/s1 |
| InChIKey | IKTFEADDZGDEOS-NRFANRHFSA-N |
| XLogP | 5.00 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|